C19H17FN2O3 — CID 175131853
[(1S)-1-(6-fluoro-3-phenylmethoxyquinolin-2-yl)ethyl] carbamate (PubChem CID 175131853) has the molecular formula C19H17FN2O3 and a molecular weight of 340.35 g/mol. Its IUPAC name is [(1S)-1-(6-fluoro-3-phenylmethoxyquinolin-2-yl)ethyl] carbamate.
| Compound Name | [(1S)-1-(6-fluoro-3-phenylmethoxyquinolin-2-yl)ethyl] carbamate |
|---|---|
| PubChem CID | 175131853 |
| Molecular Formula | C19H17FN2O3 |
| Molecular Weight | 340.35 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | [(1S)-1-(6-fluoro-3-phenylmethoxyquinolin-2-yl)ethyl] carbamate |
| SMILES | C[C@H](OC(N)=O)c1nc2ccc(F)cc2cc1OCc1ccccc1 |
| InChI | InChI=1S/C19H17FN2O3/c1-12(25-19(21)23)18-17(24-11-13-5-3-2-4-6-13)10-14-9-15(20)7-8-16(14)22-18/h2-10,12H,11H2,1H3,(H2,21,23)/t12-/m0/s1 |
| InChIKey | RZSLQFBZSSTXEE-LBPRGKRZSA-N |
| XLogP | 4.11 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.35 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |