About 3-O-benzyl 1-O-(6-fluoroindol-1-yl) (2S)-2-propan-2-ylpropanedioate
3-O-benzyl 1-O-(6-fluoroindol-1-yl) (2S)-2-propan-2-ylpropanedioate (PubChem CID 54310611) has the molecular formula C21H20FNO4
and a molecular weight of 369.39 g/mol. Its IUPAC name is 3-O-benzyl 1-O-(6-fluoroindol-1-yl) (2S)-2-propan-2-ylpropanedioate.
Molecular Properties
| Compound Name | 3-O-benzyl 1-O-(6-fluoroindol-1-yl) (2S)-2-propan-2-ylpropanedioate |
| PubChem CID | 54310611 |
| Molecular Formula | C21H20FNO4 |
| Molecular Weight | 369.39 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | 3-O-benzyl 1-O-(6-fluoroindol-1-yl) (2S)-2-propan-2-ylpropanedioate |
| SMILES | CC(C)[C@@H](C(=O)OCc1ccccc1)C(=O)On1ccc2ccc(F)cc21 |
| InChI | InChI=1S/C21H20FNO4/c1-14(2)19(20(24)26-13-15-6-4-3-5-7-15)21(25)27-23-11-10-16-8-9-17(22)12-18(16)23/h3-12,14,19H,13H2,1-2H3/t19-/m0/s1 |
| InChIKey | SKPLVDJOBFKKEU-IBGZPJMESA-N |
| XLogP | 3.75 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.39 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-O-benzyl 1-O-(6-fluoroindol-1-yl) (2S)-2-propan-2-ylpropanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-O-benzyl 1-O-(6-fluoroindol-1-yl) (2S)-2-propan-2-ylpropanedioate?
The IUPAC name of 3-O-benzyl 1-O-(6-fluoroindol-1-yl) (2S)-2-propan-2-ylpropanedioate (CID 54310611) is 3-O-benzyl 1-O-(6-fluoroindol-1-yl) (2S)-2-propan-2-ylpropanedioate.
What is the SMILES notation for 3-O-benzyl 1-O-(6-fluoroindol-1-yl) (2S)-2-propan-2-ylpropanedioate?
The canonical SMILES for 3-O-benzyl 1-O-(6-fluoroindol-1-yl) (2S)-2-propan-2-ylpropanedioate is CC(C)[C@@H](C(=O)OCc1ccccc1)C(=O)On1ccc2ccc(F)cc21.
What is the InChIKey of 3-O-benzyl 1-O-(6-fluoroindol-1-yl) (2S)-2-propan-2-ylpropanedioate?
The InChIKey is SKPLVDJOBFKKEU-IBGZPJMESA-N. The full InChI is InChI=1S/C21H20FNO4/c1-14(2)19(20(24)26-13-15-6-4-3-5-7-15)21(25)27-23-11-10-16-8-9-17(22)12-18(16)23/h3-12,14,19H,13H2,1-2H3/t19-/m0/s1.
What are the key properties of 3-O-benzyl 1-O-(6-fluoroindol-1-yl) (2S)-2-propan-2-ylpropanedioate?
3-O-benzyl 1-O-(6-fluoroindol-1-yl) (2S)-2-propan-2-ylpropanedioate has a molecular weight of 369.39 g/mol, XLogP of 3.75, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-O-benzyl 1-O-(6-fluoroindol-1-yl) (2S)-2-propan-2-ylpropanedioate is sourced from PubChem (CID 54310611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).