C23H19FN2O2 — CID 134963239
benzyl N-[(R)-(4-fluorophenyl)-indol-1-ylmethyl]carbamate (PubChem CID 134963239) has the molecular formula C23H19FN2O2 and a molecular weight of 374.42 g/mol. Its IUPAC name is benzyl N-[(R)-(4-fluorophenyl)-indol-1-ylmethyl]carbamate.
| Compound Name | benzyl N-[(R)-(4-fluorophenyl)-indol-1-ylmethyl]carbamate |
|---|---|
| PubChem CID | 134963239 |
| Molecular Formula | C23H19FN2O2 |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | benzyl N-[(R)-(4-fluorophenyl)-indol-1-ylmethyl]carbamate |
| SMILES | O=C(N[C@@H](c1ccc(F)cc1)n1ccc2ccccc21)OCc1ccccc1 |
| InChI | InChI=1S/C23H19FN2O2/c24-20-12-10-19(11-13-20)22(26-15-14-18-8-4-5-9-21(18)26)25-23(27)28-16-17-6-2-1-3-7-17/h1-15,22H,16H2,(H,25,27)/t22-/m1/s1 |
| InChIKey | QNNUTFAHUHFERE-JOCHJYFZSA-N |
| XLogP | 5.25 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |