C21H18N2O2S — CID 134963247
benzyl N-[(R)-indol-1-yl(thiophen-2-yl)methyl]carbamate (PubChem CID 134963247) has the molecular formula C21H18N2O2S and a molecular weight of 362.45 g/mol. Its IUPAC name is benzyl N-[(R)-indol-1-yl(thiophen-2-yl)methyl]carbamate.
| Compound Name | benzyl N-[(R)-indol-1-yl(thiophen-2-yl)methyl]carbamate |
|---|---|
| PubChem CID | 134963247 |
| Molecular Formula | C21H18N2O2S |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | benzyl N-[(R)-indol-1-yl(thiophen-2-yl)methyl]carbamate |
| SMILES | O=C(N[C@@H](c1cccs1)n1ccc2ccccc21)OCc1ccccc1 |
| InChI | InChI=1S/C21H18N2O2S/c24-21(25-15-16-7-2-1-3-8-16)22-20(19-11-6-14-26-19)23-13-12-17-9-4-5-10-18(17)23/h1-14,20H,15H2,(H,22,24)/t20-/m1/s1 |
| InChIKey | DNASMEJWYSOKTP-HXUWFJFHSA-N |
| XLogP | 5.18 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |