C13H19FN2O3 — CID 175183675
[(1R)-1-[2-[(3R)-3-aminobutoxy]-5-fluorophenyl]ethyl] carbamate (PubChem CID 175183675) has the molecular formula C13H19FN2O3 and a molecular weight of 270.30 g/mol. Its IUPAC name is [(1R)-1-[2-[(3R)-3-aminobutoxy]-5-fluorophenyl]ethyl] carbamate.
| Compound Name | [(1R)-1-[2-[(3R)-3-aminobutoxy]-5-fluorophenyl]ethyl] carbamate |
|---|---|
| PubChem CID | 175183675 |
| Molecular Formula | C13H19FN2O3 |
| Molecular Weight | 270.30 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | [(1R)-1-[2-[(3R)-3-aminobutoxy]-5-fluorophenyl]ethyl] carbamate |
| SMILES | C[C@@H](N)CCOc1ccc(F)cc1[C@@H](C)OC(N)=O |
| InChI | InChI=1S/C13H19FN2O3/c1-8(15)5-6-18-12-4-3-10(14)7-11(12)9(2)19-13(16)17/h3-4,7-9H,5-6,15H2,1-2H3,(H2,16,17)/t8-,9-/m1/s1 |
| InChIKey | LSTKCVRUPPYBBR-RKDXNWHRSA-N |
| XLogP | 2.10 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.30 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |