C6H11ClN2O4 — CID 175132511
formamide;(3R)-2-oxopyrrolidine-3-carboxylic acid;hydrochloride (PubChem CID 175132511) has the molecular formula C6H11ClN2O4 and a molecular weight of 210.62 g/mol. Its IUPAC name is formamide;(3R)-2-oxopyrrolidine-3-carboxylic acid;hydrochloride.
| Compound Name | formamide;(3R)-2-oxopyrrolidine-3-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 175132511 |
| Molecular Formula | C6H11ClN2O4 |
| Molecular Weight | 210.62 g/mol |
| Exact Mass | 210.04 |
| IUPAC Name | formamide;(3R)-2-oxopyrrolidine-3-carboxylic acid;hydrochloride |
| SMILES | Cl.NC=O.O=C(O)[C@@H]1CCNC1=O |
| InChI | InChI=1S/C5H7NO3.CH3NO.ClH/c7-4-3(5(8)9)1-2-6-4;2-1-3;/h3H,1-2H2,(H,6,7)(H,8,9);1H,(H2,2,3);1H/t3-;;/m1../s1 |
| InChIKey | RWZPSDHZOKWOHK-HWYNEVGZSA-N |
| XLogP | -1.27 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.62 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|