About formamide;(3R)-2-oxopyrrolidine-3-carboxylic acid;hydrochloride
formamide;(3R)-2-oxopyrrolidine-3-carboxylic acid;hydrochloride (PubChem CID 175132511) has the molecular formula C6H11ClN2O4
and a molecular weight of 210.62 g/mol. Its IUPAC name is formamide;(3R)-2-oxopyrrolidine-3-carboxylic acid;hydrochloride.
Molecular Properties
| Compound Name | formamide;(3R)-2-oxopyrrolidine-3-carboxylic acid;hydrochloride |
| PubChem CID | 175132511 |
| Molecular Formula | C6H11ClN2O4 |
| Molecular Weight | 210.62 g/mol |
| Exact Mass | 210.04 |
| IUPAC Name | formamide;(3R)-2-oxopyrrolidine-3-carboxylic acid;hydrochloride |
| SMILES | Cl.NC=O.O=C(O)[C@@H]1CCNC1=O |
| InChI | InChI=1S/C5H7NO3.CH3NO.ClH/c7-4-3(5(8)9)1-2-6-4;2-1-3;/h3H,1-2H2,(H,6,7)(H,8,9);1H,(H2,2,3);1H/t3-;;/m1../s1 |
| InChIKey | RWZPSDHZOKWOHK-HWYNEVGZSA-N |
| XLogP | -1.27 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.62 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze formamide;(3R)-2-oxopyrrolidine-3-carboxylic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formamide;(3R)-2-oxopyrrolidine-3-carboxylic acid;hydrochloride?
The IUPAC name of formamide;(3R)-2-oxopyrrolidine-3-carboxylic acid;hydrochloride (CID 175132511) is formamide;(3R)-2-oxopyrrolidine-3-carboxylic acid;hydrochloride.
What is the SMILES notation for formamide;(3R)-2-oxopyrrolidine-3-carboxylic acid;hydrochloride?
The canonical SMILES for formamide;(3R)-2-oxopyrrolidine-3-carboxylic acid;hydrochloride is Cl.NC=O.O=C(O)[C@@H]1CCNC1=O.
What is the InChIKey of formamide;(3R)-2-oxopyrrolidine-3-carboxylic acid;hydrochloride?
The InChIKey is RWZPSDHZOKWOHK-HWYNEVGZSA-N. The full InChI is InChI=1S/C5H7NO3.CH3NO.ClH/c7-4-3(5(8)9)1-2-6-4;2-1-3;/h3H,1-2H2,(H,6,7)(H,8,9);1H,(H2,2,3);1H/t3-;;/m1../s1.
What are the key properties of formamide;(3R)-2-oxopyrrolidine-3-carboxylic acid;hydrochloride?
formamide;(3R)-2-oxopyrrolidine-3-carboxylic acid;hydrochloride has a molecular weight of 210.62 g/mol, XLogP of -1.27, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for formamide;(3R)-2-oxopyrrolidine-3-carboxylic acid;hydrochloride is sourced from PubChem (CID 175132511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).