C24H23F6N2OP — CID 175133086
4-[2-[[N-methyl-3-(trifluoromethyl)anilino]-phenylphosphoryl]propan-2-yl]-2-(trifluoromethyl)aniline (PubChem CID 175133086) has the molecular formula C24H23F6N2OP and a molecular weight of 500.42 g/mol. Its IUPAC name is 4-[2-[[N-methyl-3-(trifluoromethyl)anilino]-phenylphosphoryl]propan-2-yl]-2-(trifluoromethyl)aniline.
| Compound Name | 4-[2-[[N-methyl-3-(trifluoromethyl)anilino]-phenylphosphoryl]propan-2-yl]-2-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 175133086 |
| Molecular Formula | C24H23F6N2OP |
| Molecular Weight | 500.42 g/mol |
| Exact Mass | 500.15 |
| IUPAC Name | 4-[2-[[N-methyl-3-(trifluoromethyl)anilino]-phenylphosphoryl]propan-2-yl]-2-(trifluoromethyl)aniline |
| SMILES | CN(c1cccc(C(F)(F)F)c1)P(=O)(c1ccccc1)C(C)(C)c1ccc(N)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H23F6N2OP/c1-22(2,16-12-13-21(31)20(15-16)24(28,29)30)34(33,19-10-5-4-6-11-19)32(3)18-9-7-8-17(14-18)23(25,26)27/h4-15H,31H2,1-3H3 |
| InChIKey | UOKHJDFVBFCCCK-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.42 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|