C19H20F3NO2 — CID 67705898
2-[2-amino-4-(trifluoromethyl)phenyl]-2-hydroxy-3,3-dimethyl-1-phenylbutan-1-one (PubChem CID 67705898) has the molecular formula C19H20F3NO2 and a molecular weight of 351.37 g/mol. Its IUPAC name is 2-[2-amino-4-(trifluoromethyl)phenyl]-2-hydroxy-3,3-dimethyl-1-phenylbutan-1-one.
| Compound Name | 2-[2-amino-4-(trifluoromethyl)phenyl]-2-hydroxy-3,3-dimethyl-1-phenylbutan-1-one |
|---|---|
| PubChem CID | 67705898 |
| Molecular Formula | C19H20F3NO2 |
| Molecular Weight | 351.37 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | 2-[2-amino-4-(trifluoromethyl)phenyl]-2-hydroxy-3,3-dimethyl-1-phenylbutan-1-one |
| SMILES | CC(C)(C)C(O)(C(=O)c1ccccc1)c1ccc(C(F)(F)F)cc1N |
| InChI | InChI=1S/C19H20F3NO2/c1-17(2,3)18(25,16(24)12-7-5-4-6-8-12)14-10-9-13(11-15(14)23)19(20,21)22/h4-11,25H,23H2,1-3H3 |
| InChIKey | SFXMOTIVZZBOFR-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.37 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|