C15H21BrN2O4 — CID 175134235
tert-butyl 5-bromo-3-(tert-butylcarbamoyloxy)pyridine-2-carboxylate (PubChem CID 175134235) has the molecular formula C15H21BrN2O4 and a molecular weight of 373.25 g/mol. Its IUPAC name is tert-butyl 5-bromo-3-(tert-butylcarbamoyloxy)pyridine-2-carboxylate.
| Compound Name | tert-butyl 5-bromo-3-(tert-butylcarbamoyloxy)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 175134235 |
| Molecular Formula | C15H21BrN2O4 |
| Molecular Weight | 373.25 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | tert-butyl 5-bromo-3-(tert-butylcarbamoyloxy)pyridine-2-carboxylate |
| SMILES | CC(C)(C)NC(=O)Oc1cc(Br)cnc1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H21BrN2O4/c1-14(2,3)18-13(20)21-10-7-9(16)8-17-11(10)12(19)22-15(4,5)6/h7-8H,1-6H3,(H,18,20) |
| InChIKey | ANAGCHUZGJYMNT-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.25 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |