C19H42N4O2S2 — CID 175135359
carbamothioic S-acid;N,N-dibutylbutan-1-amine;piperidin-1-ylcarbamothioic S-acid (PubChem CID 175135359) has the molecular formula C19H42N4O2S2 and a molecular weight of 422.71 g/mol. Its IUPAC name is carbamothioic S-acid;N,N-dibutylbutan-1-amine;piperidin-1-ylcarbamothioic S-acid.
| Compound Name | carbamothioic S-acid;N,N-dibutylbutan-1-amine;piperidin-1-ylcarbamothioic S-acid |
|---|---|
| PubChem CID | 175135359 |
| Molecular Formula | C19H42N4O2S2 |
| Molecular Weight | 422.71 g/mol |
| Exact Mass | 422.27 |
| IUPAC Name | carbamothioic S-acid;N,N-dibutylbutan-1-amine;piperidin-1-ylcarbamothioic S-acid |
| SMILES | CCCCN(CCCC)CCCC.NC(=O)S.O=C(S)NN1CCCCC1 |
| InChI | InChI=1S/C12H27N.C6H12N2OS.CH3NOS/c1-4-7-10-13(11-8-5-2)12-9-6-3;9-6(10)7-8-4-2-1-3-5-8;2-1(3)4/h4-12H2,1-3H3;1-5H2,(H2,7,9,10);(H3,2,3,4) |
| InChIKey | QOOQMCJJLCNXLK-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.71 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|