C23H21ClO2 — CID 175136983
2-chloro-6-(2,3,4,5-tetramethyl-6-phenylphenyl)benzoic acid (PubChem CID 175136983) has the molecular formula C23H21ClO2 and a molecular weight of 364.87 g/mol. Its IUPAC name is 2-chloro-6-(2,3,4,5-tetramethyl-6-phenylphenyl)benzoic acid.
| Compound Name | 2-chloro-6-(2,3,4,5-tetramethyl-6-phenylphenyl)benzoic acid |
|---|---|
| PubChem CID | 175136983 |
| Molecular Formula | C23H21ClO2 |
| Molecular Weight | 364.87 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 2-chloro-6-(2,3,4,5-tetramethyl-6-phenylphenyl)benzoic acid |
| SMILES | Cc1c(C)c(C)c(-c2cccc(Cl)c2C(=O)O)c(-c2ccccc2)c1C |
| InChI | InChI=1S/C23H21ClO2/c1-13-14(2)16(4)21(18-11-8-12-19(24)22(18)23(25)26)20(15(13)3)17-9-6-5-7-10-17/h5-12H,1-4H3,(H,25,26) |
| InChIKey | LSLKALLHJCIELI-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.87 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |