C20H29N3O — CID 175138004
4-[2-(2,2-diethylheptoxy)phenyl]triazine (PubChem CID 175138004) has the molecular formula C20H29N3O and a molecular weight of 327.47 g/mol. Its IUPAC name is 4-[2-(2,2-diethylheptoxy)phenyl]triazine.
| Compound Name | 4-[2-(2,2-diethylheptoxy)phenyl]triazine |
|---|---|
| PubChem CID | 175138004 |
| Molecular Formula | C20H29N3O |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.23 |
| IUPAC Name | 4-[2-(2,2-diethylheptoxy)phenyl]triazine |
| SMILES | CCCCCC(CC)(CC)COc1ccccc1-c1ccnnn1 |
| InChI | InChI=1S/C20H29N3O/c1-4-7-10-14-20(5-2,6-3)16-24-19-12-9-8-11-17(19)18-13-15-21-23-22-18/h8-9,11-13,15H,4-7,10,14,16H2,1-3H3 |
| InChIKey | XQFBATIYBOHCMG-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|