C26H33N3O2 — CID 23154398
5-[2-(3-ethyloctan-3-yloxy)phenyl]-4-(2-methoxyphenyl)triazine (PubChem CID 23154398) has the molecular formula C26H33N3O2 and a molecular weight of 419.57 g/mol. Its IUPAC name is 5-[2-(3-ethyloctan-3-yloxy)phenyl]-4-(2-methoxyphenyl)triazine.
| Compound Name | 5-[2-(3-ethyloctan-3-yloxy)phenyl]-4-(2-methoxyphenyl)triazine |
|---|---|
| PubChem CID | 23154398 |
| Molecular Formula | C26H33N3O2 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.26 |
| IUPAC Name | 5-[2-(3-ethyloctan-3-yloxy)phenyl]-4-(2-methoxyphenyl)triazine |
| SMILES | CCCCCC(CC)(CC)Oc1ccccc1-c1cnnnc1-c1ccccc1OC |
| InChI | InChI=1S/C26H33N3O2/c1-5-8-13-18-26(6-2,7-3)31-24-17-12-9-14-20(24)22-19-27-29-28-25(22)21-15-10-11-16-23(21)30-4/h9-12,14-17,19H,5-8,13,18H2,1-4H3 |
| InChIKey | WRXPNRVPDSKKLN-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|