C28H23Cl2F3N4O4S — CID 175138504
5-[2-[[3,5-dichloro-4-(1-oxobut-2-en-2-yl)benzoyl]amino]-4-[3-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-1-carboxylic acid (PubChem CID 175138504) has the molecular formula C28H23Cl2F3N4O4S and a molecular weight of 639.48 g/mol. Its IUPAC name is 5-[2-[[3,5-dichloro-4-(1-oxobut-2-en-2-yl)benzoyl]amino]-4-[3-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-1-carboxylic acid.
| Compound Name | 5-[2-[[3,5-dichloro-4-(1-oxobut-2-en-2-yl)benzoyl]amino]-4-[3-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-1-carboxylic acid |
|---|---|
| PubChem CID | 175138504 |
| Molecular Formula | C28H23Cl2F3N4O4S |
| Molecular Weight | 639.48 g/mol |
| Exact Mass | 638.08 |
| IUPAC Name | 5-[2-[[3,5-dichloro-4-(1-oxobut-2-en-2-yl)benzoyl]amino]-4-[3-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-1-carboxylic acid |
| SMILES | CC=C(C=O)c1c(Cl)cc(C(=O)Nc2nc(-c3cccc(C(F)(F)F)c3)c(N3CC4CCN(C(=O)O)C4C3)s2)cc1Cl |
| InChI | InChI=1S/C28H23Cl2F3N4O4S/c1-2-14(13-38)22-19(29)9-17(10-20(22)30)24(39)35-26-34-23(15-4-3-5-18(8-15)28(31,32)33)25(42-26)36-11-16-6-7-37(27(40)41)21(16)12-36/h2-5,8-10,13,16,21H,6-7,11-12H2,1H3,(H,40,41)(H,34,35,39) |
| InChIKey | YIXKQKLZHPNGRU-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 102.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.48 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|