C27H24Cl2F3N5O3S — CID 175140509
tert-butyl 5-[2-[(5,6-dichloropyridine-3-carbonyl)amino]-4-[3-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]-2,3,3a,4-tetrahydropyrrolo[2,3-c]pyrrole-1-carboxylate (PubChem CID 175140509) has the molecular formula C27H24Cl2F3N5O3S and a molecular weight of 626.49 g/mol. Its IUPAC name is tert-butyl 5-[2-[(5,6-dichloropyridine-3-carbonyl)amino]-4-[3-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]-2,3,3a,4-tetrahydropyrrolo[2,3-c]pyrrole-1-carboxylate.
| Compound Name | tert-butyl 5-[2-[(5,6-dichloropyridine-3-carbonyl)amino]-4-[3-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]-2,3,3a,4-tetrahydropyrrolo[2,3-c]pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 175140509 |
| Molecular Formula | C27H24Cl2F3N5O3S |
| Molecular Weight | 626.49 g/mol |
| Exact Mass | 625.09 |
| IUPAC Name | tert-butyl 5-[2-[(5,6-dichloropyridine-3-carbonyl)amino]-4-[3-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]-2,3,3a,4-tetrahydropyrrolo[2,3-c]pyrrole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2CN(c3sc(NC(=O)c4cnc(Cl)c(Cl)c4)nc3-c3cccc(C(F)(F)F)c3)C=C21 |
| InChI | InChI=1S/C27H24Cl2F3N5O3S/c1-26(2,3)40-25(39)37-8-7-15-12-36(13-19(15)37)23-20(14-5-4-6-17(9-14)27(30,31)32)34-24(41-23)35-22(38)16-10-18(28)21(29)33-11-16/h4-6,9-11,13,15H,7-8,12H2,1-3H3,(H,34,35,38) |
| InChIKey | VHJMXDUTNQCODB-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.49 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|