About trans-(2R,3R)-3-(4-hydroxyphenyl)-2-phenylcyclobutane-1-carboxylic acid
trans-(2R,3R)-3-(4-hydroxyphenyl)-2-phenylcyclobutane-1-carboxylic acid (PubChem CID 175139457) has the molecular formula C17H16O3
and a molecular weight of 268.31 g/mol. Its IUPAC name is trans-(2R,3R)-3-(4-hydroxyphenyl)-2-phenylcyclobutane-1-carboxylic acid.
Molecular Properties
| Compound Name | trans-(2R,3R)-3-(4-hydroxyphenyl)-2-phenylcyclobutane-1-carboxylic acid |
| PubChem CID | 175139457 |
| Molecular Formula | C17H16O3 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | trans-(2R,3R)-3-(4-hydroxyphenyl)-2-phenylcyclobutane-1-carboxylic acid |
| SMILES | O=C(O)C1C[C@@H](c2ccc(O)cc2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C17H16O3/c18-13-8-6-11(7-9-13)14-10-15(17(19)20)16(14)12-4-2-1-3-5-12/h1-9,14-16,18H,10H2,(H,19,20)/t14-,15?,16+/m0/s1 |
| InChIKey | RKFORADFAOSOAE-DLDKDUQYSA-N |
| XLogP | 3.36 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze trans-(2R,3R)-3-(4-hydroxyphenyl)-2-phenylcyclobutane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(2R,3R)-3-(4-hydroxyphenyl)-2-phenylcyclobutane-1-carboxylic acid?
The IUPAC name of trans-(2R,3R)-3-(4-hydroxyphenyl)-2-phenylcyclobutane-1-carboxylic acid (CID 175139457) is trans-(2R,3R)-3-(4-hydroxyphenyl)-2-phenylcyclobutane-1-carboxylic acid.
What is the SMILES notation for trans-(2R,3R)-3-(4-hydroxyphenyl)-2-phenylcyclobutane-1-carboxylic acid?
The canonical SMILES for trans-(2R,3R)-3-(4-hydroxyphenyl)-2-phenylcyclobutane-1-carboxylic acid is O=C(O)C1C[C@@H](c2ccc(O)cc2)[C@H]1c1ccccc1.
What is the InChIKey of trans-(2R,3R)-3-(4-hydroxyphenyl)-2-phenylcyclobutane-1-carboxylic acid?
The InChIKey is RKFORADFAOSOAE-DLDKDUQYSA-N. The full InChI is InChI=1S/C17H16O3/c18-13-8-6-11(7-9-13)14-10-15(17(19)20)16(14)12-4-2-1-3-5-12/h1-9,14-16,18H,10H2,(H,19,20)/t14-,15?,16+/m0/s1.
What are the key properties of trans-(2R,3R)-3-(4-hydroxyphenyl)-2-phenylcyclobutane-1-carboxylic acid?
trans-(2R,3R)-3-(4-hydroxyphenyl)-2-phenylcyclobutane-1-carboxylic acid has a molecular weight of 268.31 g/mol, XLogP of 3.36, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(2R,3R)-3-(4-hydroxyphenyl)-2-phenylcyclobutane-1-carboxylic acid is sourced from PubChem (CID 175139457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).