C25H33N5O4S2 — CID 175140978
tert-butyl (3R)-3-[[[5-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyrazin-2-yl]methylamino]methylsulfanyl]piperidine-1-carboxylate (PubChem CID 175140978) has the molecular formula C25H33N5O4S2 and a molecular weight of 531.70 g/mol. Its IUPAC name is tert-butyl (3R)-3-[[[5-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyrazin-2-yl]methylamino]methylsulfanyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[[[5-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyrazin-2-yl]methylamino]methylsulfanyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 175140978 |
| Molecular Formula | C25H33N5O4S2 |
| Molecular Weight | 531.70 g/mol |
| Exact Mass | 531.20 |
| IUPAC Name | tert-butyl (3R)-3-[[[5-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyrazin-2-yl]methylamino]methylsulfanyl]piperidine-1-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)n2ccc3nc(CNCS[C@@H]4CCCN(C(=O)OC(C)(C)C)C4)cnc32)cc1 |
| InChI | InChI=1S/C25H33N5O4S2/c1-18-7-9-21(10-8-18)36(32,33)30-13-11-22-23(30)27-15-19(28-22)14-26-17-35-20-6-5-12-29(16-20)24(31)34-25(2,3)4/h7-11,13,15,20,26H,5-6,12,14,16-17H2,1-4H3/t20-/m1/s1 |
| InChIKey | JDTNHOFIIIRMHJ-HXUWFJFHSA-N |
| XLogP | 4.16 |
| TPSA | 106.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.70 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|