About hydroxymethyl oxetane-3-carboxylate
hydroxymethyl oxetane-3-carboxylate (PubChem CID 175148015) has the molecular formula C5H8O4
and a molecular weight of 132.11 g/mol. Its IUPAC name is hydroxymethyl oxetane-3-carboxylate.
Molecular Properties
| Compound Name | hydroxymethyl oxetane-3-carboxylate |
| PubChem CID | 175148015 |
| Molecular Formula | C5H8O4 |
| Molecular Weight | 132.11 g/mol |
| Exact Mass | 132.04 |
| IUPAC Name | hydroxymethyl oxetane-3-carboxylate |
| SMILES | O=C(OCO)C1COC1 |
| InChI | InChI=1S/C5H8O4/c6-3-9-5(7)4-1-8-2-4/h4,6H,1-3H2 |
| InChIKey | QJQWNMZSFQHQOD-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.11 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze hydroxymethyl oxetane-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydroxymethyl oxetane-3-carboxylate?
The IUPAC name of hydroxymethyl oxetane-3-carboxylate (CID 175148015) is hydroxymethyl oxetane-3-carboxylate.
What is the SMILES notation for hydroxymethyl oxetane-3-carboxylate?
The canonical SMILES for hydroxymethyl oxetane-3-carboxylate is O=C(OCO)C1COC1.
What is the InChIKey of hydroxymethyl oxetane-3-carboxylate?
The InChIKey is QJQWNMZSFQHQOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O4/c6-3-9-5(7)4-1-8-2-4/h4,6H,1-3H2.
What are the key properties of hydroxymethyl oxetane-3-carboxylate?
hydroxymethyl oxetane-3-carboxylate has a molecular weight of 132.11 g/mol, XLogP of -0.87, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for hydroxymethyl oxetane-3-carboxylate is sourced from PubChem (CID 175148015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).