C15H12F3NO3 — CID 175149197
[3-[[2-(trifluoromethyl)phenyl]methoxy]phenyl] carbamate (PubChem CID 175149197) has the molecular formula C15H12F3NO3 and a molecular weight of 311.26 g/mol. Its IUPAC name is [3-[[2-(trifluoromethyl)phenyl]methoxy]phenyl] carbamate.
| Compound Name | [3-[[2-(trifluoromethyl)phenyl]methoxy]phenyl] carbamate |
|---|---|
| PubChem CID | 175149197 |
| Molecular Formula | C15H12F3NO3 |
| Molecular Weight | 311.26 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | [3-[[2-(trifluoromethyl)phenyl]methoxy]phenyl] carbamate |
| SMILES | NC(=O)Oc1cccc(OCc2ccccc2C(F)(F)F)c1 |
| InChI | InChI=1S/C15H12F3NO3/c16-15(17,18)13-7-2-1-4-10(13)9-21-11-5-3-6-12(8-11)22-14(19)20/h1-8H,9H2,(H2,19,20) |
| InChIKey | BWSWIVSUCHHIST-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.26 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |