C17H16F3NO3 — CID 30011094
ethyl N-[3-[[2-(trifluoromethyl)phenyl]methoxy]phenyl]carbamate (PubChem CID 30011094) has the molecular formula C17H16F3NO3 and a molecular weight of 339.31 g/mol. Its IUPAC name is ethyl N-[3-[[2-(trifluoromethyl)phenyl]methoxy]phenyl]carbamate.
| Compound Name | ethyl N-[3-[[2-(trifluoromethyl)phenyl]methoxy]phenyl]carbamate |
|---|---|
| PubChem CID | 30011094 |
| Molecular Formula | C17H16F3NO3 |
| Molecular Weight | 339.31 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | ethyl N-[3-[[2-(trifluoromethyl)phenyl]methoxy]phenyl]carbamate |
| SMILES | CCOC(=O)Nc1cccc(OCc2ccccc2C(F)(F)F)c1 |
| InChI | InChI=1S/C17H16F3NO3/c1-2-23-16(22)21-13-7-5-8-14(10-13)24-11-12-6-3-4-9-15(12)17(18,19)20/h3-10H,2,11H2,1H3,(H,21,22) |
| InChIKey | VLXZNRVNRFBNSW-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.31 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |