C21H26N2O4 — CID 29183042
ethyl N-[3-[2-(2-tert-butylanilino)-2-oxoethoxy]phenyl]carbamate (PubChem CID 29183042) has the molecular formula C21H26N2O4 and a molecular weight of 370.45 g/mol. Its IUPAC name is ethyl N-[3-[2-(2-tert-butylanilino)-2-oxoethoxy]phenyl]carbamate.
| Compound Name | ethyl N-[3-[2-(2-tert-butylanilino)-2-oxoethoxy]phenyl]carbamate |
|---|---|
| PubChem CID | 29183042 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | ethyl N-[3-[2-(2-tert-butylanilino)-2-oxoethoxy]phenyl]carbamate |
| SMILES | CCOC(=O)Nc1cccc(OCC(=O)Nc2ccccc2C(C)(C)C)c1 |
| InChI | InChI=1S/C21H26N2O4/c1-5-26-20(25)22-15-9-8-10-16(13-15)27-14-19(24)23-18-12-7-6-11-17(18)21(2,3)4/h6-13H,5,14H2,1-4H3,(H,22,25)(H,23,24) |
| InChIKey | GJZVPSWBLYCZBS-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |