C10H26N2O5P2 — CID 175151410
N'-[butoxy-[ethoxy(ethyl)phosphoryl]phosphoryl]oxyethane-1,2-diamine (PubChem CID 175151410) has the molecular formula C10H26N2O5P2 and a molecular weight of 316.28 g/mol. Its IUPAC name is N'-[butoxy-[ethoxy(ethyl)phosphoryl]phosphoryl]oxyethane-1,2-diamine.
| Compound Name | N'-[butoxy-[ethoxy(ethyl)phosphoryl]phosphoryl]oxyethane-1,2-diamine |
|---|---|
| PubChem CID | 175151410 |
| Molecular Formula | C10H26N2O5P2 |
| Molecular Weight | 316.28 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | N'-[butoxy-[ethoxy(ethyl)phosphoryl]phosphoryl]oxyethane-1,2-diamine |
| SMILES | CCCCOP(=O)(ONCCN)P(=O)(CC)OCC |
| InChI | InChI=1S/C10H26N2O5P2/c1-4-7-10-16-19(14,17-12-9-8-11)18(13,6-3)15-5-2/h12H,4-11H2,1-3H3 |
| InChIKey | AVJIVBLRDVCROC-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.28 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|