About alumane;tris(2-aminoethylamino) phosphate
alumane;tris(2-aminoethylamino) phosphate (PubChem CID 175212348) has the molecular formula C6H24AlN6O4P
and a molecular weight of 302.25 g/mol. Its IUPAC name is alumane;tris(2-aminoethylamino) phosphate.
Molecular Properties
| Compound Name | alumane;tris(2-aminoethylamino) phosphate |
| PubChem CID | 175212348 |
| Molecular Formula | C6H24AlN6O4P |
| Molecular Weight | 302.25 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | alumane;tris(2-aminoethylamino) phosphate |
| SMILES | NCCNOP(=O)(ONCCN)ONCCN.[AlH3] |
| InChI | InChI=1S/C6H21N6O4P.Al.3H/c7-1-4-10-14-17(13,15-11-5-2-8)16-12-6-3-9;;;;/h10-12H,1-9H2;;;; |
| InChIKey | BNPDOEKTDAZUDR-UHFFFAOYSA-N |
| XLogP | -3.65 |
| TPSA | 158.91 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 302.25 |
| LogP ≤ 5 | -3.65 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze alumane;tris(2-aminoethylamino) phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of alumane;tris(2-aminoethylamino) phosphate?
The IUPAC name of alumane;tris(2-aminoethylamino) phosphate (CID 175212348) is alumane;tris(2-aminoethylamino) phosphate.
What is the SMILES notation for alumane;tris(2-aminoethylamino) phosphate?
The canonical SMILES for alumane;tris(2-aminoethylamino) phosphate is NCCNOP(=O)(ONCCN)ONCCN.[AlH3].
What is the InChIKey of alumane;tris(2-aminoethylamino) phosphate?
The InChIKey is BNPDOEKTDAZUDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H21N6O4P.Al.3H/c7-1-4-10-14-17(13,15-11-5-2-8)16-12-6-3-9;;;;/h10-12H,1-9H2;;;;.
What are the key properties of alumane;tris(2-aminoethylamino) phosphate?
alumane;tris(2-aminoethylamino) phosphate has a molecular weight of 302.25 g/mol, XLogP of -3.65, 12 rotatable bonds, 6 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for alumane;tris(2-aminoethylamino) phosphate is sourced from PubChem (CID 175212348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).