C2H7MnN2O4P — CID 175393374
(2-aminoethylamino) phosphate;manganese(2+) (PubChem CID 175393374) has the molecular formula C2H7MnN2O4P and a molecular weight of 209.00 g/mol. Its IUPAC name is (2-aminoethylamino) phosphate;manganese(2+).
| Compound Name | (2-aminoethylamino) phosphate;manganese(2+) |
|---|---|
| PubChem CID | 175393374 |
| Molecular Formula | C2H7MnN2O4P |
| Molecular Weight | 209.00 g/mol |
| Exact Mass | 208.95 |
| IUPAC Name | (2-aminoethylamino) phosphate;manganese(2+) |
| SMILES | NCCNOP(=O)([O-])[O-].[Mn+2] |
| InChI | InChI=1S/C2H9N2O4P.Mn/c3-1-2-4-8-9(5,6)7;/h4H,1-3H2,(H2,5,6,7);/q;+2/p-2 |
| InChIKey | WCICKNPJGJVDQP-UHFFFAOYSA-L |
| XLogP | -2.71 |
| TPSA | 110.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.00 |
| LogP ≤ 5 | -2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|