C4H19N3NaO16P5 — CID 175158289
sodium;[2-(2-aminoethylamino)ethylamino] [hydroxy-[hydroxy-[hydroxy(phosphonooxy)phosphoryl]oxyphosphoryl]oxyphosphoryl] hydrogen phosphate;hydride (PubChem CID 175158289) has the molecular formula C4H19N3NaO16P5 and a molecular weight of 543.06 g/mol. Its IUPAC name is sodium;[2-(2-aminoethylamino)ethylamino] [hydroxy-[hydroxy-[hydroxy(phosphonooxy)phosphoryl]oxyphosphoryl]oxyphosphoryl] hydrogen phosphate;hydride.
| Compound Name | sodium;[2-(2-aminoethylamino)ethylamino] [hydroxy-[hydroxy-[hydroxy(phosphonooxy)phosphoryl]oxyphosphoryl]oxyphosphoryl] hydrogen phosphate;hydride |
|---|---|
| PubChem CID | 175158289 |
| Molecular Formula | C4H19N3NaO16P5 |
| Molecular Weight | 543.06 g/mol |
| Exact Mass | 542.94 |
| IUPAC Name | sodium;[2-(2-aminoethylamino)ethylamino] [hydroxy-[hydroxy-[hydroxy(phosphonooxy)phosphoryl]oxyphosphoryl]oxyphosphoryl] hydrogen phosphate;hydride |
| SMILES | NCCNCCNOP(=O)(O)OP(=O)(O)OP(=O)(O)OP(=O)(O)OP(=O)(O)O.[H-].[Na+] |
| InChI | InChI=1S/C4H18N3O16P5.Na.H/c5-1-2-6-3-4-7-19-25(11,12)21-27(15,16)23-28(17,18)22-26(13,14)20-24(8,9)10;;/h6-7H,1-5H2,(H,11,12)(H,13,14)(H,15,16)(H,17,18)(H2,8,9,10);;/q;+1;-1 |
| InChIKey | SMLFNQVKMQSQAO-UHFFFAOYSA-N |
| XLogP | -4.27 |
| TPSA | 302.96 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.06 |
| LogP ≤ 5 | -4.27 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|