C9H25KN3O3P — CID 173094919
potassium;[2-(2-aminoethylamino)ethylamino]oxy-pentylphosphinic acid;hydride (PubChem CID 173094919) has the molecular formula C9H25KN3O3P and a molecular weight of 293.39 g/mol. Its IUPAC name is potassium;[2-(2-aminoethylamino)ethylamino]oxy-pentylphosphinic acid;hydride.
| Compound Name | potassium;[2-(2-aminoethylamino)ethylamino]oxy-pentylphosphinic acid;hydride |
|---|---|
| PubChem CID | 173094919 |
| Molecular Formula | C9H25KN3O3P |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | potassium;[2-(2-aminoethylamino)ethylamino]oxy-pentylphosphinic acid;hydride |
| SMILES | CCCCCP(=O)(O)ONCCNCCN.[H-].[K+] |
| InChI | InChI=1S/C9H24N3O3P.K.H/c1-2-3-4-9-16(13,14)15-12-8-7-11-6-5-10;;/h11-12H,2-10H2,1H3,(H,13,14);;/q;+1;-1 |
| InChIKey | JBHCHWFONCAJHV-UHFFFAOYSA-N |
| XLogP | -2.45 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | -2.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|