C12H33N6O3P — CID 57234029
N'-[2-[[[2-(2-aminoethylamino)ethylamino]oxy-butylphosphoryl]oxyamino]ethyl]ethane-1,2-diamine (PubChem CID 57234029) has the molecular formula C12H33N6O3P and a molecular weight of 340.41 g/mol. Its IUPAC name is N'-[2-[[[2-(2-aminoethylamino)ethylamino]oxy-butylphosphoryl]oxyamino]ethyl]ethane-1,2-diamine.
| Compound Name | N'-[2-[[[2-(2-aminoethylamino)ethylamino]oxy-butylphosphoryl]oxyamino]ethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 57234029 |
| Molecular Formula | C12H33N6O3P |
| Molecular Weight | 340.41 g/mol |
| Exact Mass | 340.24 |
| IUPAC Name | N'-[2-[[[2-(2-aminoethylamino)ethylamino]oxy-butylphosphoryl]oxyamino]ethyl]ethane-1,2-diamine |
| SMILES | CCCCP(=O)(ONCCNCCN)ONCCNCCN |
| InChI | InChI=1S/C12H33N6O3P/c1-2-3-12-22(19,20-17-10-8-15-6-4-13)21-18-11-9-16-7-5-14/h15-18H,2-14H2,1H3 |
| InChIKey | CMWFMDSRXYOHNH-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 135.69 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.41 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|