C12H32N4NaO3P — CID 173095096
sodium;[2-[2-(2-aminoethylamino)ethylamino]ethylamino]oxy-hexylphosphinic acid;hydride (PubChem CID 173095096) has the molecular formula C12H32N4NaO3P and a molecular weight of 334.38 g/mol. Its IUPAC name is sodium;[2-[2-(2-aminoethylamino)ethylamino]ethylamino]oxy-hexylphosphinic acid;hydride.
| Compound Name | sodium;[2-[2-(2-aminoethylamino)ethylamino]ethylamino]oxy-hexylphosphinic acid;hydride |
|---|---|
| PubChem CID | 173095096 |
| Molecular Formula | C12H32N4NaO3P |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | sodium;[2-[2-(2-aminoethylamino)ethylamino]ethylamino]oxy-hexylphosphinic acid;hydride |
| SMILES | CCCCCCP(=O)(O)ONCCNCCNCCN.[H-].[Na+] |
| InChI | InChI=1S/C12H31N4O3P.Na.H/c1-2-3-4-5-12-20(17,18)19-16-11-10-15-9-8-14-7-6-13;;/h14-16H,2-13H2,1H3,(H,17,18);;/q;+1;-1 |
| InChIKey | WBHNYHXIQCSGDJ-UHFFFAOYSA-N |
| XLogP | -2.47 |
| TPSA | 108.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | -2.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|