C7H19N3NaO3P — CID 175606320
sodium [2-(2-aminoethylamino)ethylamino]oxy-propylphosphinate (PubChem CID 175606320) has the molecular formula C7H19N3NaO3P and a molecular weight of 247.21 g/mol. Its IUPAC name is sodium [2-(2-aminoethylamino)ethylamino]oxy-propylphosphinate.
| Compound Name | sodium [2-(2-aminoethylamino)ethylamino]oxy-propylphosphinate |
|---|---|
| PubChem CID | 175606320 |
| Molecular Formula | C7H19N3NaO3P |
| Molecular Weight | 247.21 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | sodium [2-(2-aminoethylamino)ethylamino]oxy-propylphosphinate |
| SMILES | CCCP(=O)([O-])ONCCNCCN.[Na+] |
| InChI | InChI=1S/C7H20N3O3P.Na/c1-2-7-14(11,12)13-10-6-5-9-4-3-8;/h9-10H,2-8H2,1H3,(H,11,12);/q;+1/p-1 |
| InChIKey | WETADZBULKSBLK-UHFFFAOYSA-M |
| XLogP | -3.98 |
| TPSA | 99.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.21 |
| LogP ≤ 5 | -3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|