About tetralithium;bis(dioxidoboranyl) carbonate
tetralithium;bis(dioxidoboranyl) carbonate (PubChem CID 175154449) has the molecular formula CB2Li4O7
and a molecular weight of 173.39 g/mol. Its IUPAC name is tetralithium;bis(dioxidoboranyl) carbonate.
Molecular Properties
| Compound Name | tetralithium;bis(dioxidoboranyl) carbonate |
| PubChem CID | 175154449 |
| Molecular Formula | CB2Li4O7 |
| Molecular Weight | 173.39 g/mol |
| Exact Mass | 174.05 |
| IUPAC Name | tetralithium;bis(dioxidoboranyl) carbonate |
| SMILES | O=C(OB([O-])[O-])OB([O-])[O-].[Li+].[Li+].[Li+].[Li+] |
| InChI | InChI=1S/CB2O7.4Li/c4-1(9-2(5)6)10-3(7)8;;;;/q-4;4*+1 |
| InChIKey | UGUACQVUVWJTNM-UHFFFAOYSA-N |
| XLogP | -17.43 |
| TPSA | 127.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.39 |
| LogP ≤ 5 | -17.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tetralithium;bis(dioxidoboranyl) carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetralithium;bis(dioxidoboranyl) carbonate?
The IUPAC name of tetralithium;bis(dioxidoboranyl) carbonate (CID 175154449) is tetralithium;bis(dioxidoboranyl) carbonate.
What is the SMILES notation for tetralithium;bis(dioxidoboranyl) carbonate?
The canonical SMILES for tetralithium;bis(dioxidoboranyl) carbonate is O=C(OB([O-])[O-])OB([O-])[O-].[Li+].[Li+].[Li+].[Li+].
What is the InChIKey of tetralithium;bis(dioxidoboranyl) carbonate?
The InChIKey is UGUACQVUVWJTNM-UHFFFAOYSA-N. The full InChI is InChI=1S/CB2O7.4Li/c4-1(9-2(5)6)10-3(7)8;;;;/q-4;4*+1.
What are the key properties of tetralithium;bis(dioxidoboranyl) carbonate?
tetralithium;bis(dioxidoboranyl) carbonate has a molecular weight of 173.39 g/mol, XLogP of -17.43, 2 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for tetralithium;bis(dioxidoboranyl) carbonate is sourced from PubChem (CID 175154449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).