C25H30O10 — CID 175155273
(3-butanoyl-2,6-dihydroxy-4-methoxy-5-methylphenyl) 2,4,6-trihydroxy-3-methyl-5-(2-methylbutanoyl)benzoate (PubChem CID 175155273) has the molecular formula C25H30O10 and a molecular weight of 490.51 g/mol. Its IUPAC name is (3-butanoyl-2,6-dihydroxy-4-methoxy-5-methylphenyl) 2,4,6-trihydroxy-3-methyl-5-(2-methylbutanoyl)benzoate.
| Compound Name | (3-butanoyl-2,6-dihydroxy-4-methoxy-5-methylphenyl) 2,4,6-trihydroxy-3-methyl-5-(2-methylbutanoyl)benzoate |
|---|---|
| PubChem CID | 175155273 |
| Molecular Formula | C25H30O10 |
| Molecular Weight | 490.51 g/mol |
| Exact Mass | 490.18 |
| IUPAC Name | (3-butanoyl-2,6-dihydroxy-4-methoxy-5-methylphenyl) 2,4,6-trihydroxy-3-methyl-5-(2-methylbutanoyl)benzoate |
| SMILES | CCCC(=O)c1c(O)c(OC(=O)c2c(O)c(C)c(O)c(C(=O)C(C)CC)c2O)c(O)c(C)c1OC |
| InChI | InChI=1S/C25H30O10/c1-7-9-13(26)14-22(32)24(20(30)12(5)23(14)34-6)35-25(33)16-19(29)11(4)18(28)15(21(16)31)17(27)10(3)8-2/h10,28-32H,7-9H2,1-6H3 |
| InChIKey | SPUIZNWEXIEUHK-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 170.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.51 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|