C26H24N2O7 — CID 175158189
4-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-5-(9H-fluoren-9-ylmethoxy)-5-oxopentanoic acid (PubChem CID 175158189) has the molecular formula C26H24N2O7 and a molecular weight of 476.49 g/mol. Its IUPAC name is 4-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-5-(9H-fluoren-9-ylmethoxy)-5-oxopentanoic acid.
| Compound Name | 4-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-5-(9H-fluoren-9-ylmethoxy)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 175158189 |
| Molecular Formula | C26H24N2O7 |
| Molecular Weight | 476.49 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | 4-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-5-(9H-fluoren-9-ylmethoxy)-5-oxopentanoic acid |
| SMILES | O=C(O)CCC(NC(=O)CCN1C(=O)C=CC1=O)C(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C26H24N2O7/c29-22(13-14-28-23(30)10-11-24(28)31)27-21(9-12-25(32)33)26(34)35-15-20-18-7-3-1-5-16(18)17-6-2-4-8-19(17)20/h1-8,10-11,20-21H,9,12-15H2,(H,27,29)(H,32,33) |
| InChIKey | GHGMYHIIYIAEMZ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 130.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.49 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|