C29H30N2O7 — CID 175360768
4-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-5-(9H-fluoren-9-ylmethoxy)-5-oxopentanoic acid (PubChem CID 175360768) has the molecular formula C29H30N2O7 and a molecular weight of 518.57 g/mol. Its IUPAC name is 4-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-5-(9H-fluoren-9-ylmethoxy)-5-oxopentanoic acid.
| Compound Name | 4-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-5-(9H-fluoren-9-ylmethoxy)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 175360768 |
| Molecular Formula | C29H30N2O7 |
| Molecular Weight | 518.57 g/mol |
| Exact Mass | 518.21 |
| IUPAC Name | 4-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-5-(9H-fluoren-9-ylmethoxy)-5-oxopentanoic acid |
| SMILES | O=C(O)CCC(NC(=O)CCCCCN1C(=O)C=CC1=O)C(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C29H30N2O7/c32-25(12-2-1-7-17-31-26(33)14-15-27(31)34)30-24(13-16-28(35)36)29(37)38-18-23-21-10-5-3-8-19(21)20-9-4-6-11-22(20)23/h3-6,8-11,14-15,23-24H,1-2,7,12-13,16-18H2,(H,30,32)(H,35,36) |
| InChIKey | KEAMRTIXEBUYIR-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 130.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.57 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|