C15H22N2O3P+ — CID 175163505
2-(3-diethoxyphosphorylpropyl)cinnolin-2-ium (PubChem CID 175163505) has the molecular formula C15H22N2O3P+ and a molecular weight of 309.33 g/mol. Its IUPAC name is 2-(3-diethoxyphosphorylpropyl)cinnolin-2-ium.
| Compound Name | 2-(3-diethoxyphosphorylpropyl)cinnolin-2-ium |
|---|---|
| PubChem CID | 175163505 |
| Molecular Formula | C15H22N2O3P+ |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | 2-(3-diethoxyphosphorylpropyl)cinnolin-2-ium |
| SMILES | CCOP(=O)(CCC[n+]1ccc2ccccc2n1)OCC |
| InChI | InChI=1S/C15H22N2O3P/c1-3-19-21(18,20-4-2)13-7-11-17-12-10-14-8-5-6-9-15(14)16-17/h5-6,8-10,12H,3-4,7,11,13H2,1-2H3/q+1 |
| InChIKey | OROLCKFEKAMYGC-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 52.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|