C13H19N3O4P+ — CID 139554989
2-[1-(2-diethoxyphosphorylethyl)pyridazin-1-ium-4-yl]-1,3-oxazole (PubChem CID 139554989) has the molecular formula C13H19N3O4P+ and a molecular weight of 312.29 g/mol. Its IUPAC name is 2-[1-(2-diethoxyphosphorylethyl)pyridazin-1-ium-4-yl]-1,3-oxazole.
| Compound Name | 2-[1-(2-diethoxyphosphorylethyl)pyridazin-1-ium-4-yl]-1,3-oxazole |
|---|---|
| PubChem CID | 139554989 |
| Molecular Formula | C13H19N3O4P+ |
| Molecular Weight | 312.29 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 2-[1-(2-diethoxyphosphorylethyl)pyridazin-1-ium-4-yl]-1,3-oxazole |
| SMILES | CCOP(=O)(CC[n+]1ccc(-c2ncco2)cn1)OCC |
| InChI | InChI=1S/C13H19N3O4P/c1-3-19-21(17,20-4-2)10-8-16-7-5-12(11-15-16)13-14-6-9-18-13/h5-7,9,11H,3-4,8,10H2,1-2H3/q+1 |
| InChIKey | GYMPQGSSZDCEIE-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 78.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.29 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|