C10H8N6 — CID 162778773
2-(1,2,3-triaza-4-azanidacyclopenta-2,5-dien-5-ylmethyl)cinnolin-2-ium (PubChem CID 162778773) has the molecular formula C10H8N6 and a molecular weight of 212.22 g/mol. Its IUPAC name is 2-(1,2,3-triaza-4-azanidacyclopenta-2,5-dien-5-ylmethyl)cinnolin-2-ium.
| Compound Name | 2-(1,2,3-triaza-4-azanidacyclopenta-2,5-dien-5-ylmethyl)cinnolin-2-ium |
|---|---|
| PubChem CID | 162778773 |
| Molecular Formula | C10H8N6 |
| Molecular Weight | 212.22 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | 2-(1,2,3-triaza-4-azanidacyclopenta-2,5-dien-5-ylmethyl)cinnolin-2-ium |
| SMILES | c1ccc2n[n+](Cc3nnn[n-]3)ccc2c1 |
| InChI | InChI=1S/C10H8N6/c1-2-4-9-8(3-1)5-6-16(13-9)7-10-11-14-15-12-10/h1-6H,7H2 |
| InChIKey | MZRHYHPOYJXRHS-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 69.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.22 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|