C27H26IN3O4 — CID 175154509
benzyl 4-cinnolin-2-ium-2-yl-2-(phenylmethoxycarbonylamino)butanoate iodide (PubChem CID 175154509) has the molecular formula C27H26IN3O4 and a molecular weight of 583.43 g/mol. Its IUPAC name is benzyl 4-cinnolin-2-ium-2-yl-2-(phenylmethoxycarbonylamino)butanoate iodide.
| Compound Name | benzyl 4-cinnolin-2-ium-2-yl-2-(phenylmethoxycarbonylamino)butanoate iodide |
|---|---|
| PubChem CID | 175154509 |
| Molecular Formula | C27H26IN3O4 |
| Molecular Weight | 583.43 g/mol |
| Exact Mass | 583.10 |
| IUPAC Name | benzyl 4-cinnolin-2-ium-2-yl-2-(phenylmethoxycarbonylamino)butanoate iodide |
| SMILES | O=C(NC(CC[n+]1ccc2ccccc2n1)C(=O)OCc1ccccc1)OCc1ccccc1.[I-] |
| InChI | InChI=1S/C27H25N3O4.HI/c31-26(33-19-21-9-3-1-4-10-21)25(28-27(32)34-20-22-11-5-2-6-12-22)16-18-30-17-15-23-13-7-8-14-24(23)29-30;/h1-15,17,25H,16,18-20H2;1H |
| InChIKey | WYSKJFHJFHQBCZ-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 81.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.43 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|