C26H29IN4O5 — CID 10555608
benzyl (2S)-6-(4-carbamoylpyridazin-1-ium-1-yl)-2-(phenylmethoxycarbonylamino)hexanoate iodide (PubChem CID 10555608) has the molecular formula C26H29IN4O5 and a molecular weight of 604.45 g/mol. Its IUPAC name is benzyl (2S)-6-(4-carbamoylpyridazin-1-ium-1-yl)-2-(phenylmethoxycarbonylamino)hexanoate iodide.
| Compound Name | benzyl (2S)-6-(4-carbamoylpyridazin-1-ium-1-yl)-2-(phenylmethoxycarbonylamino)hexanoate iodide |
|---|---|
| PubChem CID | 10555608 |
| Molecular Formula | C26H29IN4O5 |
| Molecular Weight | 604.45 g/mol |
| Exact Mass | 604.12 |
| IUPAC Name | benzyl (2S)-6-(4-carbamoylpyridazin-1-ium-1-yl)-2-(phenylmethoxycarbonylamino)hexanoate iodide |
| SMILES | NC(=O)c1cc[n+](CCCC[C@H](NC(=O)OCc2ccccc2)C(=O)OCc2ccccc2)nc1.[I-] |
| InChI | InChI=1S/C26H28N4O5.HI/c27-24(31)22-14-16-30(28-17-22)15-8-7-13-23(25(32)34-18-20-9-3-1-4-10-20)29-26(33)35-19-21-11-5-2-6-12-21;/h1-6,9-12,14,16-17,23H,7-8,13,15,18-19H2,(H2-,27,29,31,33);1H/t23-;/m0./s1 |
| InChIKey | QXVZJHFKZYSVEG-BQAIUKQQSA-N |
| XLogP | -0.32 |
| TPSA | 124.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.45 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|