C23H24N3O4+ — CID 10530319
benzyl (2S)-2-(phenylmethoxycarbonylamino)-4-pyridazin-1-ium-1-ylbutanoate (PubChem CID 10530319) has the molecular formula C23H24N3O4+ and a molecular weight of 406.46 g/mol. Its IUPAC name is benzyl (2S)-2-(phenylmethoxycarbonylamino)-4-pyridazin-1-ium-1-ylbutanoate.
| Compound Name | benzyl (2S)-2-(phenylmethoxycarbonylamino)-4-pyridazin-1-ium-1-ylbutanoate |
|---|---|
| PubChem CID | 10530319 |
| Molecular Formula | C23H24N3O4+ |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | benzyl (2S)-2-(phenylmethoxycarbonylamino)-4-pyridazin-1-ium-1-ylbutanoate |
| SMILES | O=C(N[C@@H](CC[n+]1ccccn1)C(=O)OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C23H23N3O4/c27-22(29-17-19-9-3-1-4-10-19)21(13-16-26-15-8-7-14-24-26)25-23(28)30-18-20-11-5-2-6-12-20/h1-12,14-15,21H,13,16-18H2/p+1/t21-/m0/s1 |
| InChIKey | JESZERYRQZULJB-NRFANRHFSA-O |
| XLogP | 2.80 |
| TPSA | 81.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|