C26H29N4O5+ — CID 10698883
benzyl (2S)-6-(3-carbamoylpyrazin-1-ium-1-yl)-2-(phenylmethoxycarbonylamino)hexanoate (PubChem CID 10698883) has the molecular formula C26H29N4O5+ and a molecular weight of 477.54 g/mol. Its IUPAC name is benzyl (2S)-6-(3-carbamoylpyrazin-1-ium-1-yl)-2-(phenylmethoxycarbonylamino)hexanoate.
| Compound Name | benzyl (2S)-6-(3-carbamoylpyrazin-1-ium-1-yl)-2-(phenylmethoxycarbonylamino)hexanoate |
|---|---|
| PubChem CID | 10698883 |
| Molecular Formula | C26H29N4O5+ |
| Molecular Weight | 477.54 g/mol |
| Exact Mass | 477.21 |
| IUPAC Name | benzyl (2S)-6-(3-carbamoylpyrazin-1-ium-1-yl)-2-(phenylmethoxycarbonylamino)hexanoate |
| SMILES | NC(=O)c1c[n+](CCCC[C@H](NC(=O)OCc2ccccc2)C(=O)OCc2ccccc2)ccn1 |
| InChI | InChI=1S/C26H28N4O5/c27-24(31)23-17-30(16-14-28-23)15-8-7-13-22(25(32)34-18-20-9-3-1-4-10-20)29-26(33)35-19-21-11-5-2-6-12-21/h1-6,9-12,14,16-17,22H,7-8,13,15,18-19H2,(H2-,27,29,31,33)/p+1/t22-/m0/s1 |
| InChIKey | NZWOJOQLEHSXMX-QFIPXVFZSA-O |
| XLogP | 2.68 |
| TPSA | 124.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.54 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|