C7H9N5 — CID 67089361
1,2,3-benzotriazine;hydrazine (PubChem CID 67089361) has the molecular formula C7H9N5 and a molecular weight of 163.18 g/mol. Its IUPAC name is 1,2,3-benzotriazine;hydrazine.
| Compound Name | 1,2,3-benzotriazine;hydrazine |
|---|---|
| PubChem CID | 67089361 |
| Molecular Formula | C7H9N5 |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.09 |
| IUPAC Name | 1,2,3-benzotriazine;hydrazine |
| SMILES | NN.c1ccc2nnncc2c1 |
| InChI | InChI=1S/C7H5N3.H4N2/c1-2-4-7-6(3-1)5-8-10-9-7;1-2/h1-5H;1-2H2 |
| InChIKey | IMVHJXYCXNTMCM-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 90.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|