About cyclodeca[d]triazine
cyclodeca[d]triazine (PubChem CID 68541333) has the molecular formula C11H9N3
and a molecular weight of 183.21 g/mol. Its IUPAC name is cyclodeca[d]triazine.
Molecular Properties
| Compound Name | cyclodeca[d]triazine |
| PubChem CID | 68541333 |
| Molecular Formula | C11H9N3 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.08 |
| IUPAC Name | cyclodeca[d]triazine |
| SMILES | c1ccccc2nnncc2ccc1 |
| InChI | InChI=1S/C11H9N3/c1-2-4-6-8-11-10(7-5-3-1)9-12-14-13-11/h1-9H/b2-1-,3-1-,4-2-,5-3+,6-4+,7-5+,8-6+,10-7-,11-8+ |
| InChIKey | JHAHPFTVMQUOOS-DJPLKYPASA-N |
| XLogP | 2.15 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cyclodeca[d]triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclodeca[d]triazine?
The IUPAC name of cyclodeca[d]triazine (CID 68541333) is cyclodeca[d]triazine.
What is the SMILES notation for cyclodeca[d]triazine?
The canonical SMILES for cyclodeca[d]triazine is c1ccccc2nnncc2ccc1.
What is the InChIKey of cyclodeca[d]triazine?
The InChIKey is JHAHPFTVMQUOOS-DJPLKYPASA-N. The full InChI is InChI=1S/C11H9N3/c1-2-4-6-8-11-10(7-5-3-1)9-12-14-13-11/h1-9H/b2-1-,3-1-,4-2-,5-3+,6-4+,7-5+,8-6+,10-7-,11-8+.
What are the key properties of cyclodeca[d]triazine?
cyclodeca[d]triazine has a molecular weight of 183.21 g/mol, XLogP of 2.15, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclodeca[d]triazine is sourced from PubChem (CID 68541333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).