About 1,1'-biphenyl;phthalazine
1,1'-biphenyl;phthalazine (PubChem CID 158397766) has the molecular formula C20H16N2
and a molecular weight of 284.36 g/mol. Its IUPAC name is 1,1'-biphenyl;phthalazine.
Molecular Properties
| Compound Name | 1,1'-biphenyl;phthalazine |
| PubChem CID | 158397766 |
| Molecular Formula | C20H16N2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 1,1'-biphenyl;phthalazine |
| SMILES | c1ccc(-c2ccccc2)cc1.c1ccc2cnncc2c1 |
| InChI | InChI=1S/C12H10.C8H6N2/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-2-4-8-6-10-9-5-7(8)3-1/h1-10H;1-6H |
| InChIKey | GXSMYGYXVBRAQA-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,1'-biphenyl;phthalazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1'-biphenyl;phthalazine?
The IUPAC name of 1,1'-biphenyl;phthalazine (CID 158397766) is 1,1'-biphenyl;phthalazine.
What is the SMILES notation for 1,1'-biphenyl;phthalazine?
The canonical SMILES for 1,1'-biphenyl;phthalazine is c1ccc(-c2ccccc2)cc1.c1ccc2cnncc2c1.
What is the InChIKey of 1,1'-biphenyl;phthalazine?
The InChIKey is GXSMYGYXVBRAQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10.C8H6N2/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-2-4-8-6-10-9-5-7(8)3-1/h1-10H;1-6H.
What are the key properties of 1,1'-biphenyl;phthalazine?
1,1'-biphenyl;phthalazine has a molecular weight of 284.36 g/mol, XLogP of 4.98, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1'-biphenyl;phthalazine is sourced from PubChem (CID 158397766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).