C13H11F3N3O3+ — CID 154943795
(2,2,2-trifluoroacetyl) (2S)-2-amino-3-cinnolin-2-ium-2-ylpropanoate (PubChem CID 154943795) has the molecular formula C13H11F3N3O3+ and a molecular weight of 314.24 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) (2S)-2-amino-3-cinnolin-2-ium-2-ylpropanoate.
| Compound Name | (2,2,2-trifluoroacetyl) (2S)-2-amino-3-cinnolin-2-ium-2-ylpropanoate |
|---|---|
| PubChem CID | 154943795 |
| Molecular Formula | C13H11F3N3O3+ |
| Molecular Weight | 314.24 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | (2,2,2-trifluoroacetyl) (2S)-2-amino-3-cinnolin-2-ium-2-ylpropanoate |
| SMILES | N[C@@H](C[n+]1ccc2ccccc2n1)C(=O)OC(=O)C(F)(F)F |
| InChI | InChI=1S/C13H11F3N3O3/c14-13(15,16)12(21)22-11(20)9(17)7-19-6-5-8-3-1-2-4-10(8)18-19/h1-6,9H,7,17H2/q+1/t9-/m0/s1 |
| InChIKey | KFWDIFWWKJTVCO-VIFPVBQESA-N |
| XLogP | 0.48 |
| TPSA | 86.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.24 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|