C25H17N3O8 — CID 175169890
3-carbamoyl-2-[6-carboxy-2-(1H-imidazol-5-yl)-3-phenylphenyl]-5-hydroxyterephthalic acid (PubChem CID 175169890) has the molecular formula C25H17N3O8 and a molecular weight of 487.42 g/mol. Its IUPAC name is 3-carbamoyl-2-[6-carboxy-2-(1H-imidazol-5-yl)-3-phenylphenyl]-5-hydroxyterephthalic acid.
| Compound Name | 3-carbamoyl-2-[6-carboxy-2-(1H-imidazol-5-yl)-3-phenylphenyl]-5-hydroxyterephthalic acid |
|---|---|
| PubChem CID | 175169890 |
| Molecular Formula | C25H17N3O8 |
| Molecular Weight | 487.42 g/mol |
| Exact Mass | 487.10 |
| IUPAC Name | 3-carbamoyl-2-[6-carboxy-2-(1H-imidazol-5-yl)-3-phenylphenyl]-5-hydroxyterephthalic acid |
| SMILES | NC(=O)c1c(C(=O)O)c(O)cc(C(=O)O)c1-c1c(C(=O)O)ccc(-c2ccccc2)c1-c1cnc[nH]1 |
| InChI | InChI=1S/C25H17N3O8/c26-22(30)21-19(14(24(33)34)8-16(29)20(21)25(35)36)18-13(23(31)32)7-6-12(11-4-2-1-3-5-11)17(18)15-9-27-10-28-15/h1-10,29H,(H2,26,30)(H,27,28)(H,31,32)(H,33,34)(H,35,36) |
| InChIKey | KRWSMMUBUXCKDN-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 203.90 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.42 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |