C54H90O9 — CID 175173892
[1,2-diheptoxypent-1-enoxy-[[1,2-diheptoxypent-1-enoxy(phenyl)methoxy]methoxymethoxy]methyl]benzene (PubChem CID 175173892) has the molecular formula C54H90O9 and a molecular weight of 883.30 g/mol. Its IUPAC name is [1,2-diheptoxypent-1-enoxy-[[1,2-diheptoxypent-1-enoxy(phenyl)methoxy]methoxymethoxy]methyl]benzene.
| Compound Name | [1,2-diheptoxypent-1-enoxy-[[1,2-diheptoxypent-1-enoxy(phenyl)methoxy]methoxymethoxy]methyl]benzene |
|---|---|
| PubChem CID | 175173892 |
| Molecular Formula | C54H90O9 |
| Molecular Weight | 883.30 g/mol |
| Exact Mass | 882.66 |
| IUPAC Name | [1,2-diheptoxypent-1-enoxy-[[1,2-diheptoxypent-1-enoxy(phenyl)methoxy]methoxymethoxy]methyl]benzene |
| SMILES | CCCCCCCOC(CCC)=C(OCCCCCCC)OC(OCOCOC(OC(OCCCCCCC)=C(CCC)OCCCCCCC)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C54H90O9/c1-7-13-17-21-31-41-56-49(35-11-5)53(58-43-33-23-19-15-9-3)62-51(47-37-27-25-28-38-47)60-45-55-46-61-52(48-39-29-26-30-40-48)63-54(59-44-34-24-20-16-10-4)50(36-12-6)57-42-32-22-18-14-8-2/h25-30,37-40,51-52H,7-24,31-36,41-46H2,1-6H3 |
| InChIKey | KLDUMFYMLNJQFT-UHFFFAOYSA-N |
| XLogP | 16.27 |
| TPSA | 83.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 883.30 |
| LogP ≤ 5 | 16.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|