About 2-sulfanyl-1,2-dihydropyridine-3-carbaldehyde
2-sulfanyl-1,2-dihydropyridine-3-carbaldehyde (PubChem CID 175176871) has the molecular formula C6H7NOS
and a molecular weight of 141.19 g/mol. Its IUPAC name is 2-sulfanyl-1,2-dihydropyridine-3-carbaldehyde.
Molecular Properties
| Compound Name | 2-sulfanyl-1,2-dihydropyridine-3-carbaldehyde |
| PubChem CID | 175176871 |
| Molecular Formula | C6H7NOS |
| Molecular Weight | 141.19 g/mol |
| Exact Mass | 141.02 |
| IUPAC Name | 2-sulfanyl-1,2-dihydropyridine-3-carbaldehyde |
| SMILES | O=CC1=CC=CNC1S |
| InChI | InChI=1S/C6H7NOS/c8-4-5-2-1-3-7-6(5)9/h1-4,6-7,9H |
| InChIKey | QVQNAUVWJUHZME-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.19 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-sulfanyl-1,2-dihydropyridine-3-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-sulfanyl-1,2-dihydropyridine-3-carbaldehyde?
The IUPAC name of 2-sulfanyl-1,2-dihydropyridine-3-carbaldehyde (CID 175176871) is 2-sulfanyl-1,2-dihydropyridine-3-carbaldehyde.
What is the SMILES notation for 2-sulfanyl-1,2-dihydropyridine-3-carbaldehyde?
The canonical SMILES for 2-sulfanyl-1,2-dihydropyridine-3-carbaldehyde is O=CC1=CC=CNC1S.
What is the InChIKey of 2-sulfanyl-1,2-dihydropyridine-3-carbaldehyde?
The InChIKey is QVQNAUVWJUHZME-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NOS/c8-4-5-2-1-3-7-6(5)9/h1-4,6-7,9H.
What are the key properties of 2-sulfanyl-1,2-dihydropyridine-3-carbaldehyde?
2-sulfanyl-1,2-dihydropyridine-3-carbaldehyde has a molecular weight of 141.19 g/mol, XLogP of 0.48, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-sulfanyl-1,2-dihydropyridine-3-carbaldehyde is sourced from PubChem (CID 175176871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).