C62H64O16S6 — CID 175179172
ethyl 2-[4-[2-[tetrakis[[4-(2-ethoxy-2-oxoethoxy)phenyl]sulfanyl]-(4-hydroxyphenyl)-λ6-sulfanyl]phenyl]sulfanylphenoxy]acetate (PubChem CID 175179172) has the molecular formula C62H64O16S6 and a molecular weight of 1257.58 g/mol. Its IUPAC name is ethyl 2-[4-[2-[tetrakis[[4-(2-ethoxy-2-oxoethoxy)phenyl]sulfanyl]-(4-hydroxyphenyl)-λ6-sulfanyl]phenyl]sulfanylphenoxy]acetate.
| Compound Name | ethyl 2-[4-[2-[tetrakis[[4-(2-ethoxy-2-oxoethoxy)phenyl]sulfanyl]-(4-hydroxyphenyl)-λ6-sulfanyl]phenyl]sulfanylphenoxy]acetate |
|---|---|
| PubChem CID | 175179172 |
| Molecular Formula | C62H64O16S6 |
| Molecular Weight | 1257.58 g/mol |
| Exact Mass | 1256.25 |
| IUPAC Name | ethyl 2-[4-[2-[tetrakis[[4-(2-ethoxy-2-oxoethoxy)phenyl]sulfanyl]-(4-hydroxyphenyl)-λ6-sulfanyl]phenyl]sulfanylphenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(Sc2ccccc2S(Sc2ccc(OCC(=O)OCC)cc2)(Sc2ccc(OCC(=O)OCC)cc2)(Sc2ccc(OCC(=O)OCC)cc2)(Sc2ccc(OCC(=O)OCC)cc2)c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C62H64O16S6/c1-6-69-58(64)39-74-45-17-27-50(28-18-45)79-56-13-11-12-14-57(56)84(55-37-15-44(63)16-38-55,80-51-29-19-46(20-30-51)75-40-59(65)70-7-2,81-52-31-21-47(22-32-52)76-41-60(66)71-8-3,82-53-33-23-48(24-34-53)77-42-61(67)72-9-4)83-54-35-25-49(26-36-54)78-43-62(68)73-10-5/h11-38,63H,6-10,39-43H2,1-5H3 |
| InChIKey | LRRFDGFABQFMGL-UHFFFAOYSA-N |
| XLogP | 14.38 |
| TPSA | 197.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 21 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 84 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1257.58 |
| LogP ≤ 5 | 14.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 21 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|