C22H27NO5S3 — CID 175180171
3-[[3-(benzylsulfinylmethyl)phenyl]disulfanyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (PubChem CID 175180171) has the molecular formula C22H27NO5S3 and a molecular weight of 481.66 g/mol. Its IUPAC name is 3-[[3-(benzylsulfinylmethyl)phenyl]disulfanyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid.
| Compound Name | 3-[[3-(benzylsulfinylmethyl)phenyl]disulfanyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
|---|---|
| PubChem CID | 175180171 |
| Molecular Formula | C22H27NO5S3 |
| Molecular Weight | 481.66 g/mol |
| Exact Mass | 481.11 |
| IUPAC Name | 3-[[3-(benzylsulfinylmethyl)phenyl]disulfanyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| SMILES | CC(C)(C)OC(=O)NC(CSSc1cccc(CS(=O)Cc2ccccc2)c1)C(=O)O |
| InChI | InChI=1S/C22H27NO5S3/c1-22(2,3)28-21(26)23-19(20(24)25)13-29-30-18-11-7-10-17(12-18)15-31(27)14-16-8-5-4-6-9-16/h4-12,19H,13-15H2,1-3H3,(H,23,26)(H,24,25) |
| InChIKey | QFLOBZCOYKJFTR-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.66 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|