C23H43N5O4S4 — CID 175182109
bis[2-(1,2,5-dithiazepane-5-carbonylamino)-3,3-dimethylbutyl]carbamic acid (PubChem CID 175182109) has the molecular formula C23H43N5O4S4 and a molecular weight of 581.90 g/mol. Its IUPAC name is bis[2-(1,2,5-dithiazepane-5-carbonylamino)-3,3-dimethylbutyl]carbamic acid.
| Compound Name | bis[2-(1,2,5-dithiazepane-5-carbonylamino)-3,3-dimethylbutyl]carbamic acid |
|---|---|
| PubChem CID | 175182109 |
| Molecular Formula | C23H43N5O4S4 |
| Molecular Weight | 581.90 g/mol |
| Exact Mass | 581.22 |
| IUPAC Name | bis[2-(1,2,5-dithiazepane-5-carbonylamino)-3,3-dimethylbutyl]carbamic acid |
| SMILES | CC(C)(C)C(CN(CC(NC(=O)N1CCSSCC1)C(C)(C)C)C(=O)O)NC(=O)N1CCSSCC1 |
| InChI | InChI=1S/C23H43N5O4S4/c1-22(2,3)17(24-19(29)26-7-11-33-34-12-8-26)15-28(21(31)32)16-18(23(4,5)6)25-20(30)27-9-13-35-36-14-10-27/h17-18H,7-16H2,1-6H3,(H,24,29)(H,25,30)(H,31,32) |
| InChIKey | FBYVVNBLDUNCCH-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 105.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.90 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|